- Garcinone D
-
- $89.00
-
2026-04-20
- CAS:107390-08-9
- Purity: 99.96%
- Supply Ability: 10g
- Garcinone D
-
- $9.80
-
2020-02-07
- CAS:107390-08-9
- Min. Order: 1KG
- Purity: ＞98%HPLC
- Supply Ability: 20 tons
|
| | garcinone D Basic information |
| Product Name: | garcinone D | | Synonyms: | garcinone D;1,3,6-Trihydroxy-8-(3-hydroxy-3-methylbutyl)-7-methoxy-2-(3-methyl-2-buten-1-yl)-9H-xanthen-9-one;1,3,6-trihydroxy-8-(3-hydroxy-3-methylbutyl)-7-methoxy-2-(3-methylbut-2-enyl)xanthen-9-one;9H-Xanthen-9-one,1,3,6-trihydroxy-8-(3-hydroxy-3-methylbutyl)-7-methoxy-2-(3-methyl-2-buten-1-yl)-;1,3,6-Trihydroxy-8-(3-hydroxy-3-methylbutyl)-7-methoxy-2-(3-methylbut-2-en-1-yl)-9H-xanthen-9-one;Garcinone D-RM;Garcinone D, 10 mM in DMSO | | CAS: | 107390-08-9 | | MF: | C24H28O7 | | MW: | 428.47 | | EINECS: | | | Product Categories: | chemical reagent;pharmaceutical intermediate;phytochemical;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract | | Mol File: | 107390-08-9.mol |  |
| | garcinone D Chemical Properties |
| Melting point | 202-204℃ | | Boiling point | 674.2±55.0 °C(Predicted) | | density | 1.304 | | storage temp. | 2-8°C | | solubility | DMSO: 100 mg/ml | | form | A crystalline solid | | pka | 7.22±0.20(Predicted) | | color | Light yellow to yellow | | InChI | 1S/C24H28O7/c1-12(2)6-7-13-15(25)10-18-20(21(13)27)22(28)19-14(8-9-24(3,4)29)23(30-5)16(26)11-17(19)31-18/h6,10-11,25-27,29H,7-9H2,1-5H3 | | InChIKey | TYALNCRUIKOKGP-UHFFFAOYSA-N | | SMILES | [o]1c2c([c](c3c1cc(c(c3CCC(O)(C)C)OC)O)=O)c(c(c(c2)O)CC=C(C)C)O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | garcinone D Usage And Synthesis |
| Uses | Garcinone D is a lead compound to promote proliferation of endogenous neural stem cells (NSCs). | | IC 50 | p-STAT3 |
| | garcinone D Preparation Products And Raw materials |
|