| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Pentafluorophenyl 4-vinylbenzoate
CAS:864069-04-5
Purity:99% (HPLC) Package:1G Remarks:774553-1G
|
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
| Products Intro: |
Product Name:Pentafluorophenyl 4-vinylbenzoate
CAS:864069-04-5
Purity:99% (HPLC) Package:1g;10g;100g;1KG;5KG
|
| Company Name: |
Shanghai Haohong Pharmaceutical Co., Ltd.
|
| Tel: |
400-8210725 4008210725 |
| Email: |
malulu@leyan.com |
| Products Intro: |
Product Name:2,3,4,5,6-Pentafluorophenyl 4-ethenylbenzoate
CAS:864069-04-5
Purity:97%
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Products Intro: |
Product Name:Pentafluorophenyl 4-vinylbenzoate 99% (HPLC)
CAS:864069-04-5
Purity:99% (HPLC) Package:1g Remarks:NULL
|
|
| | activated ester styrene Basic information |
| Product Name: | activated ester styrene | | Synonyms: | 4-styrene pentafluorophenoate;activated ester styrene;Pentafluorophenyl 4-vinylbenzoate;PFP ester monomer;Pentafluorophenyl 4-vinylbenzoate 99% (HPLC);Benzoic acid, 4-ethenyl-, 2,3,4,5,6-pentafluorophenyl ester;Perfluorophenyl 4-vinylbenzoate;2,3,4,5,6-Pentafluorophenyl 4-ethenylbenzoate | | CAS: | 864069-04-5 | | MF: | C15H7F5O2 | | MW: | 314.21 | | EINECS: | | | Product Categories: | | | Mol File: | 864069-04-5.mol |  |
| | activated ester styrene Chemical Properties |
| Melting point | 39-44°C | | Boiling point | 413.3±45.0 °C(Predicted) | | density | 1.429±0.06 g/cm3(Predicted) | | Fp | >110℃ | | storage temp. | 2-8°C | | form | solid | | InChI | 1S/C15H7F5O2/c1-2-7-3-5-8(6-4-7)15(21)22-14-12(19)10(17)9(16)11(18)13(14)20/h2-6H,1H2 | | InChIKey | QLSHRSPPXSAGTR-UHFFFAOYSA-N | | SMILES | Fc1c(F)c(F)c(OC(=O)c2ccc(C=C)cc2)c(F)c1F |
| Hazard Codes | N | | Risk Statements | 50/53 | | Safety Statements | 60-61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1 |
| | activated ester styrene Usage And Synthesis |
| Uses | This styrene monomer contains a highly reactive "activated ester" for coupling reactions with alcohols or amines prior to polymerization; allowing for easy use in making customized architectures. |
| | activated ester styrene Preparation Products And Raw materials |
|