| Company Name: |
Beijing HwrkChemical Technology Co., Ltd
|
| Tel: |
89508211 18501085097 |
| Email: |
sales.bj@hwrkchemical.com |
| Products Intro: |
Product Name:TRIISOPROPYL PHOSPHATE
CAS:513-02-0
Purity:95% Package:5g;25g;100g
|
TRIISOPROPYL PHOSPHATE manufacturers
|
| | TRIISOPROPYL PHOSPHATE Basic information |
| | TRIISOPROPYL PHOSPHATE Chemical Properties |
| Boiling point | 224 °C(lit.) | | density | 0.970 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.4070(lit.) | | Fp | 23 °C | | solubility | Chloroform (Slightly), Methanol (Sparingly) | | form | Oil | | color | Colourless | | InChI | 1S/C9H21O4P/c1-7(2)11-14(10,12-8(3)4)13-9(5)6/h7-9H,1-6H3 | | InChIKey | OXFUXNFMHFCELM-UHFFFAOYSA-N | | SMILES | CC(C)OP(=O)(OC(C)C)OC(C)C |
| Hazard Codes | Xi | | Risk Statements | 10-36/37/38-50 | | Safety Statements | 16-26-36-61 | | RIDADR | UN 1993 3/PG 2 | | WGK Germany | 3 | | HazardClass | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Aquatic Acute 1
Eye Irrit. 2 |
| | TRIISOPROPYL PHOSPHATE Usage And Synthesis |
| Uses | Triisopropyl phosphate may be used as an analytical reference standard for the quantification of the analyte in petroleum samples and crude oil using two-dimensional gas chromatography technique. | | General Description | Triisopropyl phosphate is an alkyl phosphate commonly found in petroleum and crude oil products. |
| | TRIISOPROPYL PHOSPHATE Preparation Products And Raw materials |
|