- 3-Bromobenzophenone
-
-
2026-06-30
- CAS:1016-77-9
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1000kg
- 3-Bromobenzophenone
-
- $9.00
-
2026-05-28
- CAS:1016-77-9
- Min. Order: 1KG
- Purity: 99.9
- Supply Ability: 1 ton
- 3-Bromobenzophenone
-
- $1.10
-
2025-11-18
- CAS:1016-77-9
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons Min
|
| | 3-Bromobenzophenone Basic information |
| | 3-Bromobenzophenone Chemical Properties |
| Melting point | 74.5-77.5 °C(lit.) | | Boiling point | 347.5°C (rough estimate) | | density | 1.4245 (rough estimate) | | refractive index | 1.5130 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C13H9BrO/c14-12-8-4-7-11(9-12)13(15)10-5-2-1-3-6-10/h1-9H | | InChIKey | XNUMUNIJQMSNNN-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC(Br)=C1)(C1=CC=CC=C1)=O | | CAS DataBase Reference | 1016-77-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25-37/39-26 | | WGK Germany | 3 | | HS Code | 29147000 | | Storage Class | 11 - Combustible Solids |
| | 3-Bromobenzophenone Usage And Synthesis |
| Chemical Properties | Off-white to beige-yellowish or orange powder |
| | 3-Bromobenzophenone Preparation Products And Raw materials |
|