|
|
| | N-Fmoc-N'-Boc-L-2,3-Diaminopropionic acid Basic information |
| | N-Fmoc-N'-Boc-L-2,3-Diaminopropionic acid Chemical Properties |
| Melting point | 131-139 .°C | | Boiling point | 652.5±55.0 °C(Predicted) | | density | 1.263±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | powder to crystal | | pka | 3.58±0.10(Predicted) | | color | White to Almost white | | Water Solubility | Slightly soluble in water. | | BRN | 7057792 | | Major Application | peptide synthesis | | InChIKey | PKAUMAVONPSDRW-IBGZPJMESA-N | | SMILES | C(O)(=O)[C@H](CNC(OC(C)(C)C)=O)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O | | CAS DataBase Reference | 162558-25-0(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10 | | HS Code | 2924 29 70 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | N-Fmoc-N'-Boc-L-2,3-Diaminopropionic acid Usage And Synthesis |
| Chemical Properties | White powder | | Uses | As lysine residue its 3-amino group is often used for carrying a tag moiety such as a fluorescent dye, a quencher or biotin. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | N-Fmoc-N'-Boc-L-2,3-Diaminopropionic acid Preparation Products And Raw materials |
|