| Company Name: |
GL Biochem (Shanghai) Ltd
|
| Tel: |
21-61263452 13641803416 |
| Email: |
ymbetter@glbiochem.com |
| Products Intro: |
Product Name:Pyr-Phe-Leu-pNA
CAS:85901-57-1
Purity:95% HPLC,98% HPLC Package:10mg, 25mg, 50mg, 100mg, 500mg, 1g,10g
|
|
| | PYR-PHE-LEU-PNA Basic information |
| Product Name: | PYR-PHE-LEU-PNA | | Synonyms: | L-PYROGLUTAMYL-L-PHENYLALANYL-L-LEUCINE P-NITROANILIDE;PGLU-PHE-LEU P-NITROANILIDE;PYR-PHE-LEU-PNA;pyroglutamyl-phenylalanyl-leucine-4-nitroanilide;Pyr-FG-pNA;PYR-PHE-GLY-PNA;PYR-FL-PNA;L-Leucinamide, 5-oxo-L-prolyl-L-phenylalanyl-N-(4-nitrophenyl)- | | CAS: | 85901-57-1 | | MF: | C26H31N5O6 | | MW: | 509.56 | | EINECS: | | | Product Categories: | Activity;Enzyme Substrates;Fluorogenic | | Mol File: | 85901-57-1.mol |  |
| | PYR-PHE-LEU-PNA Chemical Properties |
| Boiling point | 916.4±65.0 °C(Predicted) | | density | 1.293±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | ethanol: 10mg/mL, clear, colorless to faintly yellow | | pka | 12.46±0.70(Predicted) | | form | powder | | InChIKey | NLVMZXVGZDVXDA-UHFFFAOYSA-N | | SMILES | CC(C)CC(NC(=O)C(Cc1ccccc1)NC(=O)C2CCC(=O)N2)C(=O)Nc3ccc(cc3)N(=O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | PYR-PHE-LEU-PNA Usage And Synthesis |
| Uses | Chromogenic substrate for thiol proteases such as papain, ficin and bromelain. |
| | PYR-PHE-LEU-PNA Preparation Products And Raw materials |
|