|
|
| | 2-Amino-2-methyl-3-phenylpropionic acid Basic information |
| Product Name: | 2-Amino-2-methyl-3-phenylpropionic acid | | Synonyms: | ALPHA-ME-DL-PHENYLALANINE;A-METHYL-DL-PHENYLALANINE;à-methyl-dl-phenylalanine;N-Methyl-DL-phenylalanine;H-a-Me-DL-Phe-OH;ɑ-Methyl-DL-phenylalanine, 98%;(2S)-2-Amino-3-(2-methylphenyl)propionic acid;α-Me-DL-Phe-OH | | CAS: | 1132-26-9 | | MF: | C10H13NO2 | | MW: | 179.22 | | EINECS: | | | Product Categories: | | | Mol File: | 1132-26-9.mol |  |
| | 2-Amino-2-methyl-3-phenylpropionic acid Chemical Properties |
| Melting point | 293-294 °C (dec.)(lit.) | | Boiling point | 312.8±30.0 °C(Predicted) | | density | 1.166±0.06 g/cm3(Predicted) | | storage temp. | Store at RT. | | form | Powder | | pka | 2.25±0.10(Predicted) | | color | White | | BRN | 2803960 | | Major Application | peptide synthesis | | InChI | InChI=1S/C10H13NO2/c1-10(11,9(12)13)7-8-5-3-2-4-6-8/h2-6H,7,11H2,1H3,(H,12,13) | | InChIKey | HYOWVAAEQCNGLE-UHFFFAOYSA-N | | SMILES | C1(C=CC=CC=1)CC(N)(C)C(=O)O | | CAS DataBase Reference | 1132-26-9(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 29224999 | | Storage Class | 11 - Combustible Solids |
| | 2-Amino-2-methyl-3-phenylpropionic acid Usage And Synthesis |
| Chemical Properties | White powder | | Uses | peptide synthesis | | Definition | ChEBI: Alpha-Methylphenylalanine is a monocarboxylic acid and a member of benzenes. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | 2-Amino-2-methyl-3-phenylpropionic acid Preparation Products And Raw materials |
|